CAS 90016-93-6 appears in our catalog under these names: 1-Iodonaphthalen-2-amine, 98%, 1-Iodo-2-naphthalenamine, 98%, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g.
1-iodonaphthalen-2-amine (CAS 90016-93-6) is a chemical compound with the molecular formula C10H8IN and a molecular weight of 269.08 g/mol. IUPAC name: 1-iodonaphthalen-2-amine. InChIKey: VFKAZALEEBHHAG-UHFFFAOYSA-N.
| Molecular formula | C10H8IN |
|---|---|
| Molecular weight | 269.08 g/mol |
| IUPAC name | 1-iodonaphthalen-2-amine |
| InChIKey | VFKAZALEEBHHAG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=C2I)N |
Computed by PubChem (NCBI)