CAS 215608-32-5 appears in our catalog under these names: (R)-3-(((Benzyloxy)carbonyl)amino)-4-methylpentanoic acid, 95%, (R)–3–(((benzyloxy)carbonyl)amino)–4–methylpentanoic acid, (R)-3-(((benzyloxy)carbonyl)amino)-4-methylpentanoic acid, 98%, 98%, CBZ-D-BETA-HOMOVALINE, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g.
(3R)-4-methyl-3-(phenylmethoxycarbonylamino)pentanoic acid (CAS 215608-32-5) is a chemical compound with the molecular formula C14H19NO4 and a molecular weight of 265.30 g/mol. IUPAC name: (3R)-4-methyl-3-(phenylmethoxycarbonylamino)pentanoic acid. InChIKey: RKKWOAKMXYWOIM-GFCCVEGCSA-N.
| Molecular formula | C14H19NO4 |
|---|---|
| Molecular weight | 265.30 g/mol |
| IUPAC name | (3R)-4-methyl-3-(phenylmethoxycarbonylamino)pentanoic acid |
| InChIKey | RKKWOAKMXYWOIM-GFCCVEGCSA-N |
| SMILES | CC(C)[C@@H](CC(=O)O)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)