Products 2156696-60-3

CAS 2156696-60-3 is the registry number for 2‐Bromo‐4'‐chloro‐4‐methyl‐1,1'‐biphenyl, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

2-bromo-1-(4-chlorophenyl)-4-methylbenzene (CAS 2156696-60-3) is a chemical compound with the molecular formula C13H10BrCl and a molecular weight of 281.57 g/mol. IUPAC name: 2-bromo-1-(4-chlorophenyl)-4-methylbenzene. InChIKey: YVRFRWPIPIMEIK-UHFFFAOYSA-N.

Identity
Molecular formulaC13H10BrCl
Molecular weight281.57 g/mol
IUPAC name2-bromo-1-(4-chlorophenyl)-4-methylbenzene
InChIKeyYVRFRWPIPIMEIK-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1)C2=CC=C(C=C2)Cl)Br

Computed by PubChem (NCBI)