CAS 2156696-60-3 is the registry number for 2‐Bromo‐4'‐chloro‐4‐methyl‐1,1'‐biphenyl, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-bromo-1-(4-chlorophenyl)-4-methylbenzene (CAS 2156696-60-3) is a chemical compound with the molecular formula C13H10BrCl and a molecular weight of 281.57 g/mol. IUPAC name: 2-bromo-1-(4-chlorophenyl)-4-methylbenzene. InChIKey: YVRFRWPIPIMEIK-UHFFFAOYSA-N.
| Molecular formula | C13H10BrCl |
|---|---|
| Molecular weight | 281.57 g/mol |
| IUPAC name | 2-bromo-1-(4-chlorophenyl)-4-methylbenzene |
| InChIKey | YVRFRWPIPIMEIK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C2=CC=C(C=C2)Cl)Br |
Computed by PubChem (NCBI)