Products 215791-95-0

CAS 215791-95-0 appears in our catalog under these names: 4-​Thiomorpholinecarbox​ylic acid 1,​1-​dimethylethyl ester 1,​1-​dioxide, tert-Butyl thiomorpholine-4-carboxylate 1,1-dioxide, 98%, 98%, N-BOC-1,1-DIOXOTHIOMORPHOLINE, 98%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 2,5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

Tert-butyl 1,1-dioxo-1,4-thiazinane-4-carboxylate (CAS 215791-95-0) is a chemical compound with the molecular formula C9H17NO4S and a molecular weight of 235.30 g/mol. IUPAC name: tert-butyl 1,1-dioxo-1,4-thiazinane-4-carboxylate. InChIKey: UPIBPNFZLMUGQX-UHFFFAOYSA-N.

Identity
Molecular formulaC9H17NO4S
Molecular weight235.30 g/mol
IUPAC nametert-butyl 1,1-dioxo-1,4-thiazinane-4-carboxylate
InChIKeyUPIBPNFZLMUGQX-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCS(=O)(=O)CC1

Computed by PubChem (NCBI)