Products 2158541-78-5
CAS 2158541-78-5 is the registry number for tert-Butyl 4-((3-bromophenyl)(hydroxy)methyl)piperidine-1-carboxylate, 95%. Offered by: Chemat. Available pack sizes: 25mg, 50mg, 100mg.
Tert-butyl 4-[(3-bromophenyl)-hydroxymethyl]piperidine-1-carboxylate (CAS 2158541-78-5) is a chemical compound with the molecular formula C17H24BrNO3 and a molecular weight of 370.3 g/mol. IUPAC name: tert-butyl 4-[(3-bromophenyl)-hydroxymethyl]piperidine-1-carboxylate. InChIKey: HVZTWDMTZOKDAS-UHFFFAOYSA-N.
| Molecular formula | C17H24BrNO3 |
|---|---|
| Molecular weight | 370.3 g/mol |
| IUPAC name | tert-butyl 4-[(3-bromophenyl)-hydroxymethyl]piperidine-1-carboxylate |
| InChIKey | HVZTWDMTZOKDAS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)C(C2=CC(=CC=C2)Br)O |
Computed by PubChem (NCBI)