CAS 2159-42-4 appears in our catalog under these names: 3'，4'–Dimethylbenzophenone–2–carboxylic Acid, 3',4'-Dimethylbenzophenone-2-carboxylic Acid, >98.0%(T), 2-(3,4-Dimethylbenzoyl)benzoic acid, 95%, 2-(3,4-Dimethylbenzoyl)benzoic acid, 95+%, 2-(3,4-Dimethylbenzoyl)benzoic acid, ≥98%, ≥98%. Offered by: GLPBio, TCI, Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 5g, 250mg.
2-(3,4-dimethylbenzoyl)benzoic acid (CAS 2159-42-4) is a chemical compound with the molecular formula C16H14O3 and a molecular weight of 254.28 g/mol. IUPAC name: 2-(3,4-dimethylbenzoyl)benzoic acid. InChIKey: AYVFSZDAFPVJOA-UHFFFAOYSA-N.
| Molecular formula | C16H14O3 |
|---|---|
| Molecular weight | 254.28 g/mol |
| IUPAC name | 2-(3,4-dimethylbenzoyl)benzoic acid |
| InChIKey | AYVFSZDAFPVJOA-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)C2=CC=CC=C2C(=O)O)C |
Computed by PubChem (NCBI)