CAS 2159048-62-9 appears in our catalog under these names: 3-Bromo-5-phenyl-1h-pyrazole, 95%, 3-Bromo-5-phenyl-1H-pyrazole, 95%, 95%. Offered by: Combi-blocks, Chemat, Ambeed. Available pack sizes: 250mg, 100mg, 1g, 25mg, 50mg.
5-bromo-3-phenyl-1H-pyrazole (CAS 2159048-62-9) is a chemical compound with the molecular formula C9H7BrN2 and a molecular weight of 223.07 g/mol. IUPAC name: 5-bromo-3-phenyl-1H-pyrazole. InChIKey: UHFVURICDHUWHP-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2 |
|---|---|
| Molecular weight | 223.07 g/mol |
| IUPAC name | 5-bromo-3-phenyl-1H-pyrazole |
| InChIKey | UHFVURICDHUWHP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NNC(=C2)Br |
Computed by PubChem (NCBI)