CAS 215928-66-8 appears in our catalog under these names: 6-(4-Chlorophenyl)-3h,4h-thieno[3,2-d]pyrimidin-4-one, 95%, 6-(4-Chlorophenyl)thieno(3,2-d)pyrimidin-4(3H)-one. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 2,5g.
6-(4-chlorophenyl)-3H-thieno[3,2-d]pyrimidin-4-one (CAS 215928-66-8) is a chemical compound with the molecular formula C12H7ClN2OS and a molecular weight of 262.72 g/mol. IUPAC name: 6-(4-chlorophenyl)-3H-thieno[3,2-d]pyrimidin-4-one. InChIKey: GMVVGUVTWOTQNB-UHFFFAOYSA-N.
| Molecular formula | C12H7ClN2OS |
|---|---|
| Molecular weight | 262.72 g/mol |
| IUPAC name | 6-(4-chlorophenyl)-3H-thieno[3,2-d]pyrimidin-4-one |
| InChIKey | GMVVGUVTWOTQNB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC3=C(S2)C(=O)NC=N3)Cl |
Computed by PubChem (NCBI)