Products 866050-75-1
CAS 866050-75-1 is the registry number for 3-[(E)-(2-Chloro-1,3-thiazol-5-yl)methylidene]-1,3-dihydro-2h-indol-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 50mg.
(3E)-3-[(2-chloro-1,3-thiazol-5-yl)methylidene]-1H-indol-2-one (CAS 866050-75-1) is a chemical compound with the molecular formula C12H7ClN2OS and a molecular weight of 262.72 g/mol. IUPAC name: (3E)-3-[(2-chloro-1,3-thiazol-5-yl)methylidene]-1H-indol-2-one. InChIKey: CXXBPMBIVOSXGK-WEVVVXLNSA-N.
| Molecular formula | C12H7ClN2OS |
|---|---|
| Molecular weight | 262.72 g/mol |
| IUPAC name | (3E)-3-[(2-chloro-1,3-thiazol-5-yl)methylidene]-1H-indol-2-one |
| InChIKey | CXXBPMBIVOSXGK-WEVVVXLNSA-N |
| SMILES | C1=CC=C2C(=C1)/C(=C\C3=CN=C(S3)Cl)/C(=O)N2 |
Computed by PubChem (NCBI)