CAS 331761-45-6 appears in our catalog under these names: 5-(4-Chlorophenyl)thieno[2,3-d]pyrimidin-4(3H)-one, 97%, 97%, 5-(4-chlorophenyl)-1H,4H-thieno[2,3-d]pyrimidin-4-one. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 50mg.
5-(4-chlorophenyl)-3H-thieno[2,3-d]pyrimidin-4-one (CAS 331761-45-6) is a chemical compound with the molecular formula C12H7ClN2OS and a molecular weight of 262.72 g/mol. IUPAC name: 5-(4-chlorophenyl)-3H-thieno[2,3-d]pyrimidin-4-one. InChIKey: VSUODCNBLBXSNB-UHFFFAOYSA-N.
| Molecular formula | C12H7ClN2OS |
|---|---|
| Molecular weight | 262.72 g/mol |
| IUPAC name | 5-(4-chlorophenyl)-3H-thieno[2,3-d]pyrimidin-4-one |
| InChIKey | VSUODCNBLBXSNB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CSC3=C2C(=O)NC=N3)Cl |
Computed by PubChem (NCBI)