CAS 215928-68-0 appears in our catalog under these names: 6-(4-Fluorophenyl)thieno[3,2-d]pyrimidin-4(3h)-one, 95%, 6-(4-Fluorophenyl)-3,4-dihydrothieno(3,2-d)-pyrimidin-4-one, 95+%, 6-(4-Fluorophenyl)-3,4-dihydrothieno[3,2-d]-pyrimidin-4-one. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg, 500mg.
6-(4-fluorophenyl)-3H-thieno[3,2-d]pyrimidin-4-one (CAS 215928-68-0) is a chemical compound with the molecular formula C12H7FN2OS and a molecular weight of 246.26 g/mol. IUPAC name: 6-(4-fluorophenyl)-3H-thieno[3,2-d]pyrimidin-4-one. InChIKey: AUDPELUZZOKGLM-UHFFFAOYSA-N.
| Molecular formula | C12H7FN2OS |
|---|---|
| Molecular weight | 246.26 g/mol |
| IUPAC name | 6-(4-fluorophenyl)-3H-thieno[3,2-d]pyrimidin-4-one |
| InChIKey | AUDPELUZZOKGLM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC3=C(S2)C(=O)NC=N3)F |
Computed by PubChem (NCBI)