CAS 35978-37-1 appears in our catalog under these names: 5-(4-Fluorophenyl)thieno[2,3-d]pyrimidin-4(3h)-one, 95%, 5-(4-Fluorophenyl)thieno(2,3-d)pyrimidin-4(3H)-one, 98%, 5-(4-Fluorophenyl)-3H,4H-thieno[2,3-d]pyrimidin-4-one, 97%, 97%, 5-(4-Fluorophenyl)-3H-thieno[2,3-d]pyrimidin-4-one, 95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 100mg, 5g, 250mg, 10g, 1g, 500mg.
5-(4-fluorophenyl)-3H-thieno[2,3-d]pyrimidin-4-one (CAS 35978-37-1) is a chemical compound with the molecular formula C12H7FN2OS and a molecular weight of 246.26 g/mol. IUPAC name: 5-(4-fluorophenyl)-3H-thieno[2,3-d]pyrimidin-4-one. InChIKey: DARIIFLATJJEOB-UHFFFAOYSA-N.
| Molecular formula | C12H7FN2OS |
|---|---|
| Molecular weight | 246.26 g/mol |
| IUPAC name | 5-(4-fluorophenyl)-3H-thieno[2,3-d]pyrimidin-4-one |
| InChIKey | DARIIFLATJJEOB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CSC3=C2C(=O)NC=N3)F |
Computed by PubChem (NCBI)