CAS 439095-02-0 is the registry number for 6-(2-Fluorophenyl)imidazo[2,1-b]thiazole-5-carbaldehyde, 97%. Offered by: Fluorochem. Available pack sizes: 1g.
6-(2-fluorophenyl)imidazo[2,1-b][1,3]thiazole-5-carbaldehyde (CAS 439095-02-0) is a chemical compound with the molecular formula C12H7FN2OS and a molecular weight of 246.26 g/mol. IUPAC name: 6-(2-fluorophenyl)imidazo[2,1-b][1,3]thiazole-5-carbaldehyde. InChIKey: RZZWUVQMYIDSNM-UHFFFAOYSA-N.
| Molecular formula | C12H7FN2OS |
|---|---|
| Molecular weight | 246.26 g/mol |
| IUPAC name | 6-(2-fluorophenyl)imidazo[2,1-b][1,3]thiazole-5-carbaldehyde |
| InChIKey | RZZWUVQMYIDSNM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=C(N3C=CSC3=N2)C=O)F |
Computed by PubChem (NCBI)