Products 216008-29-6
CAS 216008-29-6 appears in our catalog under these names: 2,3,4,5-Tetrahydro-7-nitro-1,4-benzoxapine, 7-Nitro-2,3,4,5-tetrahydro-1,4-benzoxazepine. Offered by: TRC, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
7-nitro-2,3,4,5-tetrahydro-1,4-benzoxazepine (CAS 216008-29-6) is a chemical compound with the molecular formula C9H10N2O3 and a molecular weight of 194.19 g/mol. IUPAC name: 7-nitro-2,3,4,5-tetrahydro-1,4-benzoxazepine. InChIKey: XLSJIONOSGAQDN-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O3 |
|---|---|
| Molecular weight | 194.19 g/mol |
| IUPAC name | 7-nitro-2,3,4,5-tetrahydro-1,4-benzoxazepine |
| InChIKey | XLSJIONOSGAQDN-UHFFFAOYSA-N |
| SMILES | C1COC2=C(CN1)C=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)