Products 2161364-69-6
CAS 2161364-69-6 is the registry number for HBV-IN-25. Offered by: MedChemExpress. Available pack sizes: Get quote.
(3R)-1-(5-chloro-9-oxoxanthen-3-yl)pyrrolidine-3-carboxylic acid (CAS 2161364-69-6) is a chemical compound with the molecular formula C18H14ClNO4 and a molecular weight of 343.8 g/mol. IUPAC name: (3R)-1-(5-chloro-9-oxoxanthen-3-yl)pyrrolidine-3-carboxylic acid. InChIKey: DHVRTFMBTRRBRG-SNVBAGLBSA-N.
| Molecular formula | C18H14ClNO4 |
|---|---|
| Molecular weight | 343.8 g/mol |
| IUPAC name | (3R)-1-(5-chloro-9-oxoxanthen-3-yl)pyrrolidine-3-carboxylic acid |
| InChIKey | DHVRTFMBTRRBRG-SNVBAGLBSA-N |
| SMILES | C1CN(C[C@@H]1C(=O)O)C2=CC3=C(C=C2)C(=O)C4=C(O3)C(=CC=C4)Cl |
Computed by PubChem (NCBI)