CAS 216218-93-8 is the registry number for 8-Methyl-4,5-dihydro-[1,2,5]oxadiazolo[3,4-f]cinnoline, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
8-methyl-4,5-dihydro-[1,2,5]oxadiazolo[3,4-f]cinnoline (CAS 216218-93-8) is a chemical compound with the molecular formula C9H8N4O and a molecular weight of 188.19 g/mol. IUPAC name: 8-methyl-4,5-dihydro-[1,2,5]oxadiazolo[3,4-f]cinnoline. InChIKey: XCTGVAZZQSNJFW-UHFFFAOYSA-N.
| Molecular formula | C9H8N4O |
|---|---|
| Molecular weight | 188.19 g/mol |
| IUPAC name | 8-methyl-4,5-dihydro-[1,2,5]oxadiazolo[3,4-f]cinnoline |
| InChIKey | XCTGVAZZQSNJFW-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(CCC3=NON=C32)N=N1 |
Computed by PubChem (NCBI)