CAS 21629-48-1 appears in our catalog under these names: 7-Chloro-2,8-dimethyl-4-hydroxyquinoline, 97%, 7–Chloro–2,8–dimethyl–4–hydroxyquinoline, 7-chloro-2,8-dimethyl-1,4-dihydroquinolin-4-one, 99%(GC-MS),RG. Offered by: Combi-blocks, GLPBio, Fluorochem. Available pack sizes: 25g, 1g, 5g, 250mg.
7-chloro-2,8-dimethyl-1H-quinolin-4-one (CAS 21629-48-1) is a chemical compound with the molecular formula C11H10ClNO and a molecular weight of 207.65 g/mol. IUPAC name: 7-chloro-2,8-dimethyl-1H-quinolin-4-one. InChIKey: LOJPYUFGOCWEHF-UHFFFAOYSA-N.
| Molecular formula | C11H10ClNO |
|---|---|
| Molecular weight | 207.65 g/mol |
| IUPAC name | 7-chloro-2,8-dimethyl-1H-quinolin-4-one |
| InChIKey | LOJPYUFGOCWEHF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)C2=C(N1)C(=C(C=C2)Cl)C |
Computed by PubChem (NCBI)