Products 216444-19-8

CAS 216444-19-8 is the registry number for Ethyl 6-iodopicolinate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Ethyl 6-iodopyridine-2-carboxylate (CAS 216444-19-8) is a chemical compound with the molecular formula C8H8INO2 and a molecular weight of 277.06 g/mol. IUPAC name: ethyl 6-iodopyridine-2-carboxylate. InChIKey: AIXQRDUSGZPSIX-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8INO2
Molecular weight277.06 g/mol
IUPAC nameethyl 6-iodopyridine-2-carboxylate
InChIKeyAIXQRDUSGZPSIX-UHFFFAOYSA-N
SMILESCCOC(=O)C1=NC(=CC=C1)I

Computed by PubChem (NCBI)