CAS 216485-93-7 is the registry number for 2,2'-Dimethyl[1,1'-biphenyl]-3-amine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-methyl-3-(2-methylphenyl)aniline (CAS 216485-93-7) is a chemical compound with the molecular formula C14H15N and a molecular weight of 197.27 g/mol. IUPAC name: 2-methyl-3-(2-methylphenyl)aniline. InChIKey: MKITWUKNNFIPAV-UHFFFAOYSA-N.
| Molecular formula | C14H15N |
|---|---|
| Molecular weight | 197.27 g/mol |
| IUPAC name | 2-methyl-3-(2-methylphenyl)aniline |
| InChIKey | MKITWUKNNFIPAV-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1C2=C(C(=CC=C2)N)C |
Computed by PubChem (NCBI)