CAS 2165431-90-1 appears in our catalog under these names: Brivaracetam Impurity 35, Brivaracetam Impurity 47, (S)-2-((S)-2-Oxo-4-propylpyrrolidin-1-yl)butanoic Acid. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
(2S)-2-[(4S)-2-oxo-4-propylpyrrolidin-1-yl]butanoic acid (CAS 2165431-90-1) is a chemical compound with the molecular formula C11H19NO3 and a molecular weight of 213.27 g/mol. IUPAC name: (2S)-2-[(4S)-2-oxo-4-propylpyrrolidin-1-yl]butanoic acid. InChIKey: LTDAHGXWZNKFNP-IUCAKERBSA-N.
| Molecular formula | C11H19NO3 |
|---|---|
| Molecular weight | 213.27 g/mol |
| IUPAC name | (2S)-2-[(4S)-2-oxo-4-propylpyrrolidin-1-yl]butanoic acid |
| InChIKey | LTDAHGXWZNKFNP-IUCAKERBSA-N |
| SMILES | CCC[C@H]1CC(=O)N(C1)[C@@H](CC)C(=O)O |
Computed by PubChem (NCBI)