CAS 943986-67-2 appears in our catalog under these names: Brivaracetam Impurity 8, Brivaracetam Impurity H, Brivaracetam Impurity 1, Brivaracetam Impurity 31, Brivaracetam related compound D (~85:15 d.r.), >95% (HPLC). Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth, Sigma-Aldrich. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
(2S)-2-[(4R)-2-oxo-4-propylpyrrolidin-1-yl]butanoic acid (CAS 943986-67-2) is a chemical compound with the molecular formula C11H19NO3 and a molecular weight of 213.27 g/mol. IUPAC name: (2S)-2-[(4R)-2-oxo-4-propylpyrrolidin-1-yl]butanoic acid. InChIKey: LTDAHGXWZNKFNP-BDAKNGLRSA-N.
| Molecular formula | C11H19NO3 |
|---|---|
| Molecular weight | 213.27 g/mol |
| IUPAC name | (2S)-2-[(4R)-2-oxo-4-propylpyrrolidin-1-yl]butanoic acid |
| InChIKey | LTDAHGXWZNKFNP-BDAKNGLRSA-N |
| SMILES | CCC[C@@H]1CC(=O)N(C1)[C@@H](CC)C(=O)O |
Computed by PubChem (NCBI)