Products 2165532-10-3
CAS 2165532-10-3 is the registry number for 1-((1S,2S)-2-(3-bromophenyl)cyclopropyl)ethanone, 95%. Offered by: Chemat. Available pack sizes: 1g.
1-[(1S,2S)-2-(3-bromophenyl)cyclopropyl]ethanone (CAS 2165532-10-3) is a chemical compound with the molecular formula C11H11BrO and a molecular weight of 239.11 g/mol. IUPAC name: 1-[(1S,2S)-2-(3-bromophenyl)cyclopropyl]ethanone. InChIKey: FDJRSKBNQNNNFE-GHMZBOCLSA-N.
| Molecular formula | C11H11BrO |
|---|---|
| Molecular weight | 239.11 g/mol |
| IUPAC name | 1-[(1S,2S)-2-(3-bromophenyl)cyclopropyl]ethanone |
| InChIKey | FDJRSKBNQNNNFE-GHMZBOCLSA-N |
| SMILES | CC(=O)[C@H]1C[C@@H]1C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)