CAS 2165733-28-6 is the registry number for H-L-Tyr(O,2,6-Me3)-OH. Offered by: Iris Biotech. Available pack sizes: 50mg.
(2S)-2-amino-3-(4-methoxy-2,6-dimethylphenyl)propanoic acid (CAS 2165733-28-6) is a chemical compound with the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. IUPAC name: (2S)-2-amino-3-(4-methoxy-2,6-dimethylphenyl)propanoic acid. InChIKey: QOVSDQLRRGAZIR-NSHDSACASA-N.
| Molecular formula | C12H17NO3 |
|---|---|
| Molecular weight | 223.27 g/mol |
| IUPAC name | (2S)-2-amino-3-(4-methoxy-2,6-dimethylphenyl)propanoic acid |
| InChIKey | QOVSDQLRRGAZIR-NSHDSACASA-N |
| SMILES | CC1=CC(=CC(=C1C[C@@H](C(=O)O)N)C)OC |
Computed by PubChem (NCBI)