CAS 21658-26-4 is the registry number for 4-Nitrophenyl 4-guanidinobenzoate, 95%. Offered by: Ambeed. Available pack sizes: 100mg.
(4-nitrophenyl) 4-(diaminomethylideneamino)benzoate (CAS 21658-26-4) is a chemical compound with the molecular formula C14H12N4O4 and a molecular weight of 300.27 g/mol. IUPAC name: (4-nitrophenyl) 4-(diaminomethylideneamino)benzoate. InChIKey: CFOQGBUQTOGYKI-UHFFFAOYSA-N.
| Molecular formula | C14H12N4O4 |
|---|---|
| Molecular weight | 300.27 g/mol |
| IUPAC name | (4-nitrophenyl) 4-(diaminomethylideneamino)benzoate |
| InChIKey | CFOQGBUQTOGYKI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)OC2=CC=C(C=C2)[N+](=O)[O-])N=C(N)N |
Computed by PubChem (NCBI)