Products 937599-53-6

CAS 937599-53-6 is the registry number for 2-(9-(4-Methoxyphenyl)-6-oxo-6,9-dihydro-1H-purin-1-yl)acetic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

2-[9-(4-methoxyphenyl)-6-oxopurin-1-yl]acetic acid (CAS 937599-53-6) is a chemical compound with the molecular formula C14H12N4O4 and a molecular weight of 300.27 g/mol. IUPAC name: 2-[9-(4-methoxyphenyl)-6-oxopurin-1-yl]acetic acid. InChIKey: LSFCIDAFGLNMTC-UHFFFAOYSA-N.

Identity
Molecular formulaC14H12N4O4
Molecular weight300.27 g/mol
IUPAC name2-[9-(4-methoxyphenyl)-6-oxopurin-1-yl]acetic acid
InChIKeyLSFCIDAFGLNMTC-UHFFFAOYSA-N
SMILESCOC1=CC=C(C=C1)N2C=NC3=C2N=CN(C3=O)CC(=O)O

Computed by PubChem (NCBI)