CAS 33984-50-8 appears in our catalog under these names: 7-(p-Methoxybenzylamino)-4-nitrobenz-2-oxa-1,3-diazole, >95% (HPLC), MBD, 7-(p-Methoxybenzylamino)-4-nitrobenz-2-oxa-1,3-diazole, 99.00%, MBD, 98%, N-[(4-Methoxyphenyl)methyl]-7-nitro-2,1,3-benzoxadiazol-4-amine, 95%, 95%. Offered by: TRC, TargetMol, GLPBio, Chemat, Thermo Scientific (Acros). Available pack sizes: 100mg, 250mg, 25mg, 10mg, 1g, 5g, 50 mg, 100 mg.
N-[(4-methoxyphenyl)methyl]-4-nitro-2,1,3-benzoxadiazol-7-amine (CAS 33984-50-8) is a chemical compound with the molecular formula C14H12N4O4 and a molecular weight of 300.27 g/mol. IUPAC name: N-[(4-methoxyphenyl)methyl]-4-nitro-2,1,3-benzoxadiazol-7-amine. InChIKey: IENONFJSMWUIQQ-UHFFFAOYSA-N.
| Molecular formula | C14H12N4O4 |
|---|---|
| Molecular weight | 300.27 g/mol |
| IUPAC name | N-[(4-methoxyphenyl)methyl]-4-nitro-2,1,3-benzoxadiazol-7-amine |
| InChIKey | IENONFJSMWUIQQ-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)CNC2=CC=C(C3=NON=C23)[N+](=O)[O-] |
Computed by PubChem (NCBI)