CAS 216597-58-9 is the registry number for ((S)-1-((S)-1-phenylethyl)aziridin-2-yl)methanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
4-O-tert-butyl 3-O-methyl (3R,6S)-6-methylmorpholine-3,4-dicarboxylate (CAS 216597-58-9) is a chemical compound with the molecular formula C12H21NO5 and a molecular weight of 259.30 g/mol. IUPAC name: 4-O-tert-butyl 3-O-methyl (3R,6S)-6-methylmorpholine-3,4-dicarboxylate. InChIKey: GFQVDAIUXQADCS-DTWKUNHWSA-N.
| Molecular formula | C12H21NO5 |
|---|---|
| Molecular weight | 259.30 g/mol |
| IUPAC name | 4-O-tert-butyl 3-O-methyl (3R,6S)-6-methylmorpholine-3,4-dicarboxylate |
| InChIKey | GFQVDAIUXQADCS-DTWKUNHWSA-N |
| SMILES | C[C@H]1CN([C@H](CO1)C(=O)OC)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)