Products 2940870-75-5
CAS 2940870-75-5 is the registry number for O4-tert-butyl O3-methyl (3S,6R)-6-methylmorpholine-3,4-dicarboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-O-tert-butyl 3-O-methyl (3S,6R)-6-methylmorpholine-3,4-dicarboxylate (CAS 2940870-75-5) is a chemical compound with the molecular formula C12H21NO5 and a molecular weight of 259.30 g/mol. IUPAC name: 4-O-tert-butyl 3-O-methyl (3S,6R)-6-methylmorpholine-3,4-dicarboxylate. InChIKey: GFQVDAIUXQADCS-BDAKNGLRSA-N.
| Molecular formula | C12H21NO5 |
|---|---|
| Molecular weight | 259.30 g/mol |
| IUPAC name | 4-O-tert-butyl 3-O-methyl (3S,6R)-6-methylmorpholine-3,4-dicarboxylate |
| InChIKey | GFQVDAIUXQADCS-BDAKNGLRSA-N |
| SMILES | C[C@@H]1CN([C@@H](CO1)C(=O)OC)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)