Products 2165984-16-5
CAS 2165984-16-5 is the registry number for (3S)-3-{[(tert-butoxy)carbonyl]amino}-4-cyclopropylbutanoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(3S)-4-cyclopropyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 2165984-16-5) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: (3S)-4-cyclopropyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: HHQZEJWXWCJVFC-VIFPVBQESA-N.
| Molecular formula | C12H21NO4 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | (3S)-4-cyclopropyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | HHQZEJWXWCJVFC-VIFPVBQESA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1CC1)CC(=O)O |
Computed by PubChem (NCBI)