CAS 2166653-61-6 is the registry number for 3-Formyl-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-formyl-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole-2-carboxylic acid (CAS 2166653-61-6) is a chemical compound with the molecular formula C8H8N2O3 and a molecular weight of 180.16 g/mol. IUPAC name: 3-formyl-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole-2-carboxylic acid. InChIKey: WYYMBKAQXSOPBL-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O3 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | 3-formyl-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole-2-carboxylic acid |
| InChIKey | WYYMBKAQXSOPBL-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=NN2C1)C(=O)O)C=O |
Computed by PubChem (NCBI)