Products 2166810-88-2

CAS 2166810-88-2 is the registry number for 4-((tert-Butoxycarbonyl)amino)-2,2-difluorobutanoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2,2-difluoro-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 2166810-88-2) is a chemical compound with the molecular formula C9H15F2NO4 and a molecular weight of 239.22 g/mol. IUPAC name: 2,2-difluoro-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: JMHKYNHCPLWQGE-UHFFFAOYSA-N.

Identity
Molecular formulaC9H15F2NO4
Molecular weight239.22 g/mol
IUPAC name2,2-difluoro-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid
InChIKeyJMHKYNHCPLWQGE-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NCCC(C(=O)O)(F)F

Computed by PubChem (NCBI)