CAS 2205050-75-3 is the registry number for (R)-2-((tert-Butoxycarbonyl)amino)-3,3-difluorobutanoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-3,3-difluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 2205050-75-3) is a chemical compound with the molecular formula C9H15F2NO4 and a molecular weight of 239.22 g/mol. IUPAC name: (2R)-3,3-difluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: HGXCLAHPWUQUGT-RXMQYKEDSA-N.
| Molecular formula | C9H15F2NO4 |
|---|---|
| Molecular weight | 239.22 g/mol |
| IUPAC name | (2R)-3,3-difluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | HGXCLAHPWUQUGT-RXMQYKEDSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](C(=O)O)C(C)(F)F |
Computed by PubChem (NCBI)