CAS 467442-20-2 appears in our catalog under these names: (S)–2–((tert–Butoxycarbonyl)amino)–4,4–difluorobutanoic acid, Boc-L-DfAbu-OH, Boc-Abu(F2)-OH 97%, (S)-2-(tert-Butoxycarbonylamino)-4,4-difluorobutanoic acid, 97%, 97%, (S)-2-((tert-Butoxycarbonyl)amino)-4,4-difluorobutanoic acid, 97%. Offered by: GLPBio, Iris Biotech, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g.
(2S)-4,4-difluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 467442-20-2) is a chemical compound with the molecular formula C9H15F2NO4 and a molecular weight of 239.22 g/mol. IUPAC name: (2S)-4,4-difluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: UCCLBCNDXKDPDT-YFKPBYRVSA-N.
| Molecular formula | C9H15F2NO4 |
|---|---|
| Molecular weight | 239.22 g/mol |
| IUPAC name | (2S)-4,4-difluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | UCCLBCNDXKDPDT-YFKPBYRVSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC(F)F)C(=O)O |
Computed by PubChem (NCBI)