Products 2167069-02-3

CAS 2167069-02-3 is the registry number for 5-fluoro-3-methyl-1H,2H,3H-pyrrolo[2,3-b]pyridin-2-one, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.

Structural formula: {0} (CAS {1})

5-fluoro-3-methyl-1,3-dihydropyrrolo[2,3-b]pyridin-2-one (CAS 2167069-02-3) is a chemical compound with the molecular formula C8H7FN2O and a molecular weight of 166.15 g/mol. IUPAC name: 5-fluoro-3-methyl-1,3-dihydropyrrolo[2,3-b]pyridin-2-one. InChIKey: NKXLLTKHFGGKTB-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7FN2O
Molecular weight166.15 g/mol
IUPAC name5-fluoro-3-methyl-1,3-dihydropyrrolo[2,3-b]pyridin-2-one
InChIKeyNKXLLTKHFGGKTB-UHFFFAOYSA-N
SMILESCC1C2=C(NC1=O)N=CC(=C2)F

Computed by PubChem (NCBI)