CAS 2167095-52-3 appears in our catalog under these names: 3,3-Difluoro-1-(trifluoromethyl)cyclobutane-1-carboxylic acid, 97%, 97%, 3,3-DIFLUORO-1-(TRIFLUOROMETHYL)CYCLOBUTANE-1-CARBOXYLIC ACID, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
3,3-difluoro-1-(trifluoromethyl)cyclobutane-1-carboxylic acid (CAS 2167095-52-3) is a chemical compound with the molecular formula C6H5F5O2 and a molecular weight of 204.09 g/mol. IUPAC name: 3,3-difluoro-1-(trifluoromethyl)cyclobutane-1-carboxylic acid. InChIKey: ZGIJVVNYGUMTIL-UHFFFAOYSA-N.
| Molecular formula | C6H5F5O2 |
|---|---|
| Molecular weight | 204.09 g/mol |
| IUPAC name | 3,3-difluoro-1-(trifluoromethyl)cyclobutane-1-carboxylic acid |
| InChIKey | ZGIJVVNYGUMTIL-UHFFFAOYSA-N |
| SMILES | C1C(CC1(F)F)(C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)