Products 96250-37-2
CAS 96250-37-2 is the registry number for 2,2,3,3-Tetrafluoropropyl 2-fluoroacrylate, 97%. Offered by: Fluorochem. Available pack sizes: 1g, 5g.
2,2,3,3-tetrafluoropropyl 2-fluoroprop-2-enoate (CAS 96250-37-2) is a chemical compound with the molecular formula C6H5F5O2 and a molecular weight of 204.09 g/mol. IUPAC name: 2,2,3,3-tetrafluoropropyl 2-fluoroprop-2-enoate. InChIKey: OOPSTBSKXWPLKJ-UHFFFAOYSA-N.
| Molecular formula | C6H5F5O2 |
|---|---|
| Molecular weight | 204.09 g/mol |
| IUPAC name | 2,2,3,3-tetrafluoropropyl 2-fluoroprop-2-enoate |
| InChIKey | OOPSTBSKXWPLKJ-UHFFFAOYSA-N |
| SMILES | C=C(C(=O)OCC(C(F)F)(F)F)F |
Computed by PubChem (NCBI)
Synonyms:
Monomer FN-1, 2-Propenoic acid, 2-fluoro-, 2,2,3,3-tetrafluoropropyl ester, 2,2,3,3-Tetrafluoropropyl 2-fluoro-2-propenoate, 2,2,3,3-Tetrafluoropropyl 2-fluoroacrylate, 2,2,3,3-tetrafluoropropyl 2-fluoroprop-2-enoate, 2,2,3,3-tetrafluoropropyl-2'-fluoroacrylate, OOPSTBSKXWPLKJ-UHFFFAOYSA-N, 2,2,3,3-tetrafluoropropyl-2-fluoroacrylate, 2-Fluoro-2-propenoic acid 2,2,3,3-tetrafluoropropyl ester