CAS 356-40-1 appears in our catalog under these names: 5,5,6,6,6-Pentafluorohexane-2,4-dione, 95%, 5,5,6,6,6-Pentafluorohexane-2,4-dione. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 25g.
5,5,6,6,6-pentafluorohexane-2,4-dione (CAS 356-40-1) is a chemical compound with the molecular formula C6H5F5O2 and a molecular weight of 204.09 g/mol. IUPAC name: 5,5,6,6,6-pentafluorohexane-2,4-dione. InChIKey: URZZSPYOFOTILI-UHFFFAOYSA-N.
| Molecular formula | C6H5F5O2 |
|---|---|
| Molecular weight | 204.09 g/mol |
| IUPAC name | 5,5,6,6,6-pentafluorohexane-2,4-dione |
| InChIKey | URZZSPYOFOTILI-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(=O)C(C(F)(F)F)(F)F |
Computed by PubChem (NCBI)