CAS 2167122-34-9 is the registry number for 3-(3,5-Difluorophenyl)bicyclo[1.1.1]pentane-1-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(3,5-difluorophenyl)bicyclo[1.1.1]pentane-1-carboxylic acid (CAS 2167122-34-9) is a chemical compound with the molecular formula C12H10F2O2 and a molecular weight of 224.20 g/mol. IUPAC name: 3-(3,5-difluorophenyl)bicyclo[1.1.1]pentane-1-carboxylic acid. InChIKey: WYGZYPYWBBJQQW-UHFFFAOYSA-N.
| Molecular formula | C12H10F2O2 |
|---|---|
| Molecular weight | 224.20 g/mol |
| IUPAC name | 3-(3,5-difluorophenyl)bicyclo[1.1.1]pentane-1-carboxylic acid |
| InChIKey | WYGZYPYWBBJQQW-UHFFFAOYSA-N |
| SMILES | C1C2(CC1(C2)C(=O)O)C3=CC(=CC(=C3)F)F |
Computed by PubChem (NCBI)