CAS 2703782-15-2 is the registry number for 2-Fluoro-3-(4-fluorophenyl)bicyclo(1.1.1)pentane-1-carboxylic acid, 98%. Offered by: AmBeed. Available pack sizes: 250mg.
2-fluoro-3-(4-fluorophenyl)bicyclo[1.1.1]pentane-1-carboxylic acid (CAS 2703782-15-2) is a chemical compound with the molecular formula C12H10F2O2 and a molecular weight of 224.20 g/mol. IUPAC name: 2-fluoro-3-(4-fluorophenyl)bicyclo[1.1.1]pentane-1-carboxylic acid. InChIKey: KLFHTCGRCMXATF-UHFFFAOYSA-N.
| Molecular formula | C12H10F2O2 |
|---|---|
| Molecular weight | 224.20 g/mol |
| IUPAC name | 2-fluoro-3-(4-fluorophenyl)bicyclo[1.1.1]pentane-1-carboxylic acid |
| InChIKey | KLFHTCGRCMXATF-UHFFFAOYSA-N |
| SMILES | C1C2(CC1(C2F)C(=O)O)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)