Products 834885-12-0
CAS 834885-12-0 is the registry number for (2-(Difluoromethoxy)naphthalen-1-yl)methanol. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
[2-(difluoromethoxy)naphthalen-1-yl]methanol (CAS 834885-12-0) is a chemical compound with the molecular formula C12H10F2O2 and a molecular weight of 224.20 g/mol. IUPAC name: [2-(difluoromethoxy)naphthalen-1-yl]methanol. InChIKey: QKKFOIJXDDMAIM-UHFFFAOYSA-N.
| Molecular formula | C12H10F2O2 |
|---|---|
| Molecular weight | 224.20 g/mol |
| IUPAC name | [2-(difluoromethoxy)naphthalen-1-yl]methanol |
| InChIKey | QKKFOIJXDDMAIM-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=C2CO)OC(F)F |
Computed by PubChem (NCBI)