Products 21676-88-0
CAS 21676-88-0 appears in our catalog under these names: 4-Phenylthiophene-2-carboxylic acid, 98%, 4-Phenylthiophene-2-carboxylic acid 97%, 4-Phenylthiophene-2-Carboxylic Acid, 97%, 97%, 4-Phenylthiophene-2-carboxylic acid, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 1g, 5g, 100mg, 250mg.
4-phenylthiophene-2-carboxylic acid (CAS 21676-88-0) is a chemical compound with the molecular formula C11H8O2S and a molecular weight of 204.25 g/mol. IUPAC name: 4-phenylthiophene-2-carboxylic acid. InChIKey: DOAFBJFYWLESRS-UHFFFAOYSA-N.
| Molecular formula | C11H8O2S |
|---|---|
| Molecular weight | 204.25 g/mol |
| IUPAC name | 4-phenylthiophene-2-carboxylic acid |
| InChIKey | DOAFBJFYWLESRS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CSC(=C2)C(=O)O |
Computed by PubChem (NCBI)