CAS 29886-63-3 appears in our catalog under these names: 3-(Thiophen-2-yl)benzoic acid, 95%, 3-Thiophen-2-yl-benzoic acid, 95%, 3-(Thiophen-2-yl)benzoic acid, 98%, 98%. Offered by: Combi-blocks, Fluorochem, Chemat. Available pack sizes: 25g, 5g, 1g, 100mg, 250mg.
3-thiophen-2-ylbenzoic acid (CAS 29886-63-3) is a chemical compound with the molecular formula C11H8O2S and a molecular weight of 204.25 g/mol. IUPAC name: 3-thiophen-2-ylbenzoic acid. InChIKey: SEIZFGIUKSSIJJ-UHFFFAOYSA-N.
| Molecular formula | C11H8O2S |
|---|---|
| Molecular weight | 204.25 g/mol |
| IUPAC name | 3-thiophen-2-ylbenzoic acid |
| InChIKey | SEIZFGIUKSSIJJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)C2=CC=CS2 |
Computed by PubChem (NCBI)