CAS 23062-42-2 appears in our catalog under these names: 4-Phenylthiophene-3-carboxylic acid, 97%, 4-Phenylthiophene-3-carboxylic acid, 4-Phenylthiophene-3-carboxylic acid, 97%, 97%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 0,5g, 50mg, 100mg, 250mg, 1g.
4-phenylthiophene-3-carboxylic acid (CAS 23062-42-2) is a chemical compound with the molecular formula C11H8O2S and a molecular weight of 204.25 g/mol. IUPAC name: 4-phenylthiophene-3-carboxylic acid. InChIKey: ZNTFBJWDGATWSI-UHFFFAOYSA-N.
| Molecular formula | C11H8O2S |
|---|---|
| Molecular weight | 204.25 g/mol |
| IUPAC name | 4-phenylthiophene-3-carboxylic acid |
| InChIKey | ZNTFBJWDGATWSI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CSC=C2C(=O)O |
Computed by PubChem (NCBI)