Products 2167815-01-0
CAS 2167815-01-0 appears in our catalog under these names: 2-Oxospiro(3.5)nonane-7-carboxylic acid, 2-Oxospiro[3.5]nonane-7-carboxylic acid, 97%. Offered by: Biosynth, Ambeed, BLDpharm. Available pack sizes: 50mg, 0,5g, 100mg, 250mg, 1g, 5g.
2-oxospiro[3.5]nonane-7-carboxylic acid (CAS 2167815-01-0) is a chemical compound with the molecular formula C10H14O3 and a molecular weight of 182.22 g/mol. IUPAC name: 2-oxospiro[3.5]nonane-7-carboxylic acid. InChIKey: YVLFKKBAGHKEGK-UHFFFAOYSA-N.
| Molecular formula | C10H14O3 |
|---|---|
| Molecular weight | 182.22 g/mol |
| IUPAC name | 2-oxospiro[3.5]nonane-7-carboxylic acid |
| InChIKey | YVLFKKBAGHKEGK-UHFFFAOYSA-N |
| SMILES | C1CC2(CCC1C(=O)O)CC(=O)C2 |
Computed by PubChem (NCBI)