CAS 2168283-98-3 is the registry number for 2-Bromo-1,3-dichloro-5-ethoxybenzene, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
2-bromo-1,3-dichloro-5-ethoxybenzene (CAS 2168283-98-3) is a chemical compound with the molecular formula C8H7BrCl2O and a molecular weight of 269.95 g/mol. IUPAC name: 2-bromo-1,3-dichloro-5-ethoxybenzene. InChIKey: FIDURZGBSVWPPN-UHFFFAOYSA-N.
| Molecular formula | C8H7BrCl2O |
|---|---|
| Molecular weight | 269.95 g/mol |
| IUPAC name | 2-bromo-1,3-dichloro-5-ethoxybenzene |
| InChIKey | FIDURZGBSVWPPN-UHFFFAOYSA-N |
| SMILES | CCOC1=CC(=C(C(=C1)Cl)Br)Cl |
Computed by PubChem (NCBI)