CAS 7495-24-1 is the registry number for 2-Bromo-1-(3,4-dichlorophenyl)ethanol, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-1-(3,4-dichlorophenyl)ethanol (CAS 7495-24-1) is a chemical compound with the molecular formula C8H7BrCl2O and a molecular weight of 269.95 g/mol. IUPAC name: 2-bromo-1-(3,4-dichlorophenyl)ethanol. InChIKey: ZFMARCNWWLHGAZ-UHFFFAOYSA-N.
| Molecular formula | C8H7BrCl2O |
|---|---|
| Molecular weight | 269.95 g/mol |
| IUPAC name | 2-bromo-1-(3,4-dichlorophenyl)ethanol |
| InChIKey | ZFMARCNWWLHGAZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(CBr)O)Cl)Cl |
Computed by PubChem (NCBI)