CAS 26583-73-3 appears in our catalog under these names: 2-(2-Bromoethoxy)-1,3-dichlorobenzene, 95%, 2-(2-Bromoethoxy)-1,3-dichlorobenzene. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
2-(2-bromoethoxy)-1,3-dichlorobenzene (CAS 26583-73-3) is a chemical compound with the molecular formula C8H7BrCl2O and a molecular weight of 269.95 g/mol. IUPAC name: 2-(2-bromoethoxy)-1,3-dichlorobenzene. InChIKey: RQGVZXGJKYJQSN-UHFFFAOYSA-N.
| Molecular formula | C8H7BrCl2O |
|---|---|
| Molecular weight | 269.95 g/mol |
| IUPAC name | 2-(2-bromoethoxy)-1,3-dichlorobenzene |
| InChIKey | RQGVZXGJKYJQSN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)OCCBr)Cl |
Computed by PubChem (NCBI)