Products 2168432-60-6
CAS 2168432-60-6 is the registry number for 3-Bromo-2,5-dichlorobenzotrifluoride, 97%. Offered by: Combi-blocks. Available pack sizes: 25g, 100g, 10g, 1g, 5g.
1-bromo-2,5-dichloro-3-(trifluoromethyl)benzene (CAS 2168432-60-6) is a chemical compound with the molecular formula C7H2BrCl2F3 and a molecular weight of 293.89 g/mol. IUPAC name: 1-bromo-2,5-dichloro-3-(trifluoromethyl)benzene. InChIKey: BAGRZHCRDQHVEA-UHFFFAOYSA-N.
| Molecular formula | C7H2BrCl2F3 |
|---|---|
| Molecular weight | 293.89 g/mol |
| IUPAC name | 1-bromo-2,5-dichloro-3-(trifluoromethyl)benzene |
| InChIKey | BAGRZHCRDQHVEA-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(F)(F)F)Cl)Br)Cl |
Computed by PubChem (NCBI)