CAS 393-45-3 is the registry number for 1-Bromo-2,4-dichloro-5-(trifluoromethyl)benzene. Offered by: TRC. Available pack sizes: 100mg.
1-bromo-2,4-dichloro-5-(trifluoromethyl)benzene (CAS 393-45-3) is a chemical compound with the molecular formula C7H2BrCl2F3 and a molecular weight of 293.89 g/mol. IUPAC name: 1-bromo-2,4-dichloro-5-(trifluoromethyl)benzene. InChIKey: PZQYDFVUPWMHNC-UHFFFAOYSA-N.
| Molecular formula | C7H2BrCl2F3 |
|---|---|
| Molecular weight | 293.89 g/mol |
| IUPAC name | 1-bromo-2,4-dichloro-5-(trifluoromethyl)benzene |
| InChIKey | PZQYDFVUPWMHNC-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Br)Cl)Cl)C(F)(F)F |
Computed by PubChem (NCBI)