CAS 859794-59-5 appears in our catalog under these names: 2-Bromo-1,3-dichloro-4-(trifluoromethyl)benzene, 95%, 2-Bromo-1,3-dichloro-4-(trifluoromethyl)benzene. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 10g, 1g, 250mg, 0,5g, 50mg.
2-bromo-1,3-dichloro-4-(trifluoromethyl)benzene (CAS 859794-59-5) is a chemical compound with the molecular formula C7H2BrCl2F3 and a molecular weight of 293.89 g/mol. IUPAC name: 2-bromo-1,3-dichloro-4-(trifluoromethyl)benzene. InChIKey: UQYVMQFUNZXYEK-UHFFFAOYSA-N.
| Molecular formula | C7H2BrCl2F3 |
|---|---|
| Molecular weight | 293.89 g/mol |
| IUPAC name | 2-bromo-1,3-dichloro-4-(trifluoromethyl)benzene |
| InChIKey | UQYVMQFUNZXYEK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(F)(F)F)Cl)Br)Cl |
Computed by PubChem (NCBI)